C21H24N2O2 — CID 108726376
N-(2-indol-1-ylethyl)-4-(2-methylpropoxy)benzamide (PubChem CID 108726376) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(2-indol-1-ylethyl)-4-(2-methylpropoxy)benzamide.
| Compound Name | N-(2-indol-1-ylethyl)-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 108726376 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(2-indol-1-ylethyl)-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-16(2)15-25-19-9-7-18(8-10-19)21(24)22-12-14-23-13-11-17-5-3-4-6-20(17)23/h3-11,13,16H,12,14-15H2,1-2H3,(H,22,24) |
| InChIKey | IPRNMIRHFJHQAF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |