C21H25N3O4 — CID 10872670
[(1S,7R,9aR)-6,6-dimethyl-8-oxo-7-(4-oxoquinazolin-3-yl)-2,3,4,7,9,9a-hexahydro-1H-quinolizin-1-yl] acetate (PubChem CID 10872670) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [(1S,7R,9aR)-6,6-dimethyl-8-oxo-7-(4-oxoquinazolin-3-yl)-2,3,4,7,9,9a-hexahydro-1H-quinolizin-1-yl] acetate.
| Compound Name | [(1S,7R,9aR)-6,6-dimethyl-8-oxo-7-(4-oxoquinazolin-3-yl)-2,3,4,7,9,9a-hexahydro-1H-quinolizin-1-yl] acetate |
|---|---|
| PubChem CID | 10872670 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(1S,7R,9aR)-6,6-dimethyl-8-oxo-7-(4-oxoquinazolin-3-yl)-2,3,4,7,9,9a-hexahydro-1H-quinolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCCN2[C@@H]1CC(=O)[C@H](n1cnc3ccccc3c1=O)C2(C)C |
| InChI | InChI=1S/C21H25N3O4/c1-13(25)28-18-9-6-10-24-16(18)11-17(26)19(21(24,2)3)23-12-22-15-8-5-4-7-14(15)20(23)27/h4-5,7-8,12,16,18-19H,6,9-11H2,1-3H3/t16-,18+,19+/m1/s1 |
| InChIKey | GVBUYPLGEBOUCO-NEWSRXKRSA-N |
| XLogP | 2.09 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |