C10H12N4O2S — CID 108727687
prop-2-enyl N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)carbamate (PubChem CID 108727687) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is prop-2-enyl N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)carbamate.
| Compound Name | prop-2-enyl N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)carbamate |
|---|---|
| PubChem CID | 108727687 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | prop-2-enyl N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)carbamate |
| SMILES | C=CCOC(=O)Nc1nc2sc(C)c(C)n2n1 |
| InChI | InChI=1S/C10H12N4O2S/c1-4-5-16-10(15)12-8-11-9-14(13-8)6(2)7(3)17-9/h4H,1,5H2,2-3H3,(H,12,13,15) |
| InChIKey | COIZRBIJQSYRCS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|