C22H40O4Si — CID 10872977
methyl 4-[(3S,3aR,7S,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate (PubChem CID 10872977) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is methyl 4-[(3S,3aR,7S,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate.
| Compound Name | methyl 4-[(3S,3aR,7S,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate |
|---|---|
| PubChem CID | 10872977 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | methyl 4-[(3S,3aR,7S,7aR)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate |
| SMILES | COC(=O)CCC[C@]12CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@H]2C(C)=O |
| InChI | InChI=1S/C22H40O4Si/c1-16(23)17-12-13-18-19(26-27(6,7)21(2,3)4)10-8-14-22(17,18)15-9-11-20(24)25-5/h17-19H,8-15H2,1-7H3/t17-,18+,19+,22+/m1/s1 |
| InChIKey | CDAHEOVIWICBRD-GHDARCQNSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|