About [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate (PubChem CID 10873076) has the molecular formula C22H28O5Si
and a molecular weight of 400.55 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate.
Molecular Properties
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate |
| PubChem CID | 10873076 |
| Molecular Formula | C22H28O5Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate |
| SMILES | CC(=O)OC1COC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H28O5Si/c1-17(23)26-21-15-24-20(27-21)16-25-28(22(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21H,15-16H2,1-4H3 |
| InChIKey | ZGJIHJDPFRVRQK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate?
The IUPAC name of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate (CID 10873076) is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate.
What is the SMILES notation for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate?
The canonical SMILES for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate is CC(=O)OC1COC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1.
What is the InChIKey of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate?
The InChIKey is ZGJIHJDPFRVRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O5Si/c1-17(23)26-21-15-24-20(27-21)16-25-28(22(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21H,15-16H2,1-4H3.
What are the key properties of [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate?
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate has a molecular weight of 400.55 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-4-yl] acetate is sourced from PubChem (CID 10873076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).