C22H28O7 — CID 10873150
methyl (1R,2R)-2-methyl-5-oxo-2-[2-oxo-2-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)acetyl]cyclohex-3-ene-1-carboxylate (PubChem CID 10873150) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl (1R,2R)-2-methyl-5-oxo-2-[2-oxo-2-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)acetyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-2-methyl-5-oxo-2-[2-oxo-2-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)acetyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10873150 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | methyl (1R,2R)-2-methyl-5-oxo-2-[2-oxo-2-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)acetyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)C=C[C@@]1(C)C(=O)C(=O)C1=C(C)CCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C22H28O7/c1-13-6-9-22(28-10-11-29-22)20(2,3)16(13)17(24)18(25)21(4)8-7-14(23)12-15(21)19(26)27-5/h7-8,15H,6,9-12H2,1-5H3/t15-,21+/m0/s1 |
| InChIKey | WXMQXXHBCPZXQF-YCRPNKLZSA-N |
| XLogP | 2.33 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|