C23H20F2N4O — CID 10873204
4-(2-fluorophenyl)-12-[1-(4-fluorophenyl)ethyl]-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 10873204) has the molecular formula C23H20F2N4O and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-12-[1-(4-fluorophenyl)ethyl]-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 4-(2-fluorophenyl)-12-[1-(4-fluorophenyl)ethyl]-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 10873204 |
| Molecular Formula | C23H20F2N4O |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-(2-fluorophenyl)-12-[1-(4-fluorophenyl)ethyl]-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | CC(c1ccc(F)cc1)N1CCc2[nH]c(=O)n3cc(-c4ccccc4F)nc3c2C1 |
| InChI | InChI=1S/C23H20F2N4O/c1-14(15-6-8-16(24)9-7-15)28-11-10-20-18(12-28)22-26-21(13-29(22)23(30)27-20)17-4-2-3-5-19(17)25/h2-9,13-14H,10-12H2,1H3,(H,27,30) |
| InChIKey | RSLUSVPJPOLZSM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |