C25H42O4 — CID 10873213
[(1S,2S,4aS,8aS)-2-hydroxy-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] 3-methylbutanoate (PubChem CID 10873213) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is [(1S,2S,4aS,8aS)-2-hydroxy-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] 3-methylbutanoate.
| Compound Name | [(1S,2S,4aS,8aS)-2-hydroxy-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 10873213 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | [(1S,2S,4aS,8aS)-2-hydroxy-4-[(E)-5-hydroxy-3-methylpent-3-enyl]-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] 3-methylbutanoate |
| SMILES | CC1=C(CC/C(C)=C/CO)[C@@]2(C)CCCC(C)(C)[C@@H]2[C@H](OC(=O)CC(C)C)[C@H]1O |
| InChI | InChI=1S/C25H42O4/c1-16(2)15-20(27)29-22-21(28)18(4)19(10-9-17(3)11-14-26)25(7)13-8-12-24(5,6)23(22)25/h11,16,21-23,26,28H,8-10,12-15H2,1-7H3/b17-11+/t21-,22+,23-,25+/m0/s1 |
| InChIKey | KLRYQYMRBCEOHD-PKRSCGOWSA-N |
| XLogP | 5.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|