C24H28N2O4 — CID 10873246
4-(3,4-dimethoxyphenyl)-2-[(2-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 10873246) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-[(2-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-[(2-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10873246 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-[(2-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccccc1CN1N=C(c2ccc(OC)c(OC)c2)C2CCCCC2C1=O |
| InChI | InChI=1S/C24H28N2O4/c1-28-20-11-7-4-8-17(20)15-26-24(27)19-10-6-5-9-18(19)23(25-26)16-12-13-21(29-2)22(14-16)30-3/h4,7-8,11-14,18-19H,5-6,9-10,15H2,1-3H3 |
| InChIKey | HVZVPGFXFPHGPA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |