About carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene
carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene (PubChem CID 10873261) has the molecular formula C10H12Cl2OOs
and a molecular weight of 409.34 g/mol. Its IUPAC name is carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene |
| PubChem CID | 10873261 |
| Molecular Formula | C10H12Cl2OOs |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.Cl[Os]Cl.[C-]#[O+] |
| InChI | InChI=1S/C9H12.CO.2ClH.Os/c1-7-4-8(2)6-9(3)5-7;1-2;;;/h4-6H,1-3H3;;2*1H;/q;;;;+2/p-2 |
| InChIKey | ASDSVSGMJFWXFE-UHFFFAOYSA-L |
| XLogP | 3.95 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The IUPAC name of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene (CID 10873261) is carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene.
What is the SMILES notation for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The canonical SMILES for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.Cl[Os]Cl.[C-]#[O+].
What is the InChIKey of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The InChIKey is ASDSVSGMJFWXFE-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H12.CO.2ClH.Os/c1-7-4-8(2)6-9(3)5-7;1-2;;;/h4-6H,1-3H3;;2*1H;/q;;;;+2/p-2.
What are the key properties of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene has a molecular weight of 409.34 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene is sourced from PubChem (CID 10873261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).