carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene

C10H12Cl2OOs — CID 10873261

IUPACcarbon monoxide;dichloroosmium;1,3,5-trimethylbenzene
SMILESCc1cc(C)cc(C)c1.Cl[Os]Cl.[C-]#[O+]
InChIInChI=1S/C9H12.CO.2ClH.Os/c1-7-4-8(2)6-9(3)5-7;1-2;;;/h4-6H,1-3H3;;2*1H;/q;;;;+2/p-2
InChIKeyASDSVSGMJFWXFE-UHFFFAOYSA-L
MW409.34 g/mol
LogP3.95
Rot. Bonds

About carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene

carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene (PubChem CID 10873261) has the molecular formula C10H12Cl2OOs and a molecular weight of 409.34 g/mol. Its IUPAC name is carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene.

Molecular Properties

Compound Namecarbon monoxide;dichloroosmium;1,3,5-trimethylbenzene
PubChem CID10873261
Molecular FormulaC10H12Cl2OOs
Molecular Weight409.34 g/mol
Exact Mass409.99
IUPAC Namecarbon monoxide;dichloroosmium;1,3,5-trimethylbenzene
SMILESCc1cc(C)cc(C)c1.Cl[Os]Cl.[C-]#[O+]
InChIInChI=1S/C9H12.CO.2ClH.Os/c1-7-4-8(2)6-9(3)5-7;1-2;;;/h4-6H,1-3H3;;2*1H;/q;;;;+2/p-2
InChIKeyASDSVSGMJFWXFE-UHFFFAOYSA-L
XLogP3.95
TPSA19.90 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500409.34
LogP ≤ 53.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The IUPAC name of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene (CID 10873261) is carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene.
What is the SMILES notation for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The canonical SMILES for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.Cl[Os]Cl.[C-]#[O+].
What is the InChIKey of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
The InChIKey is ASDSVSGMJFWXFE-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H12.CO.2ClH.Os/c1-7-4-8(2)6-9(3)5-7;1-2;;;/h4-6H,1-3H3;;2*1H;/q;;;;+2/p-2.
What are the key properties of carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene?
carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene has a molecular weight of 409.34 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;dichloroosmium;1,3,5-trimethylbenzene is sourced from PubChem (CID 10873261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).