About 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine
1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine (PubChem CID 10873343) has the molecular formula C26H25FN4
and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine.
Molecular Properties
| Compound Name | 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine |
| PubChem CID | 10873343 |
| Molecular Formula | C26H25FN4 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine |
| SMILES | Fc1ccccc1N1CCN(Cc2cn(-c3ccccc3)c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C26H25FN4/c27-24-13-7-8-14-25(24)30-17-15-29(16-18-30)19-22-20-31(23-11-5-2-6-12-23)26(28-22)21-9-3-1-4-10-21/h1-14,20H,15-19H2 |
| InChIKey | NKRWGVAMPNUXFY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine?
The IUPAC name of 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine (CID 10873343) is 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine.
What is the SMILES notation for 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine?
The canonical SMILES for 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine is Fc1ccccc1N1CCN(Cc2cn(-c3ccccc3)c(-c3ccccc3)n2)CC1.
What is the InChIKey of 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine?
The InChIKey is NKRWGVAMPNUXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25FN4/c27-24-13-7-8-14-25(24)30-17-15-29(16-18-30)19-22-20-31(23-11-5-2-6-12-23)26(28-22)21-9-3-1-4-10-21/h1-14,20H,15-19H2.
What are the key properties of 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine?
1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine has a molecular weight of 412.51 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,2-diphenylimidazol-4-yl)methyl]-4-(2-fluorophenyl)piperazine is sourced from PubChem (CID 10873343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).