C17H23N3O — CID 108733576
1-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]butan-1-one (PubChem CID 108733576) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 1-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108733576 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC(c2nc3ccc(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/C17H23N3O/c1-3-4-16(21)20-9-7-13(8-10-20)17-18-14-6-5-12(2)11-15(14)19-17/h5-6,11,13H,3-4,7-10H2,1-2H3,(H,18,19) |
| InChIKey | CMQICZOSGVNMNH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |