C19H16BClN2O6 — CID 10873397
3-[(R)-borono-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 10873397) has the molecular formula C19H16BClN2O6 and a molecular weight of 414.61 g/mol. Its IUPAC name is 3-[(R)-borono-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 3-[(R)-borono-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 10873397 |
| Molecular Formula | C19H16BClN2O6 |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-[(R)-borono-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)N[C@H](B(O)O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H16BClN2O6/c1-10-15(16(23-29-10)13-7-2-3-8-14(13)21)18(24)22-17(20(27)28)11-5-4-6-12(9-11)19(25)26/h2-9,17,27-28H,1H3,(H,22,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | WDKLOBJMLAOUQT-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|