C27H28O4 — CID 10873429
(2R,3S,4S)-2,3,4-tris(phenylmethoxy)hex-5-enal (PubChem CID 10873429) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-tris(phenylmethoxy)hex-5-enal.
| Compound Name | (2R,3S,4S)-2,3,4-tris(phenylmethoxy)hex-5-enal |
|---|---|
| PubChem CID | 10873429 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2R,3S,4S)-2,3,4-tris(phenylmethoxy)hex-5-enal |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28O4/c1-2-25(29-19-22-12-6-3-7-13-22)27(31-21-24-16-10-5-11-17-24)26(18-28)30-20-23-14-8-4-9-15-23/h2-18,25-27H,1,19-21H2/t25-,26-,27-/m0/s1 |
| InChIKey | HIMSQQRMSFNULJ-QKDODKLFSA-N |
| XLogP | 5.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|