About butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate
butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 108734524) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 108734524 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CC(=O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C19H25NO4/c1-3-4-11-23-18(22)20-9-7-19(8-10-20)13-16(21)15-12-14(2)5-6-17(15)24-19/h5-6,12H,3-4,7-11,13H2,1-2H3 |
| InChIKey | QJHGLWRWGUQAKG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CID 108734524) is butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is CCCCOC(=O)N1CCC2(CC1)CC(=O)c1cc(C)ccc1O2.
What is the InChIKey of butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The InChIKey is QJHGLWRWGUQAKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4/c1-3-4-11-23-18(22)20-9-7-19(8-10-20)13-16(21)15-12-14(2)5-6-17(15)24-19/h5-6,12H,3-4,7-11,13H2,1-2H3.
What are the key properties of butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate has a molecular weight of 331.41 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-methyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 108734524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).