C19H20N4O7S — CID 108736202
2-methyl-3,5-dinitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide (PubChem CID 108736202) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is 2-methyl-3,5-dinitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 2-methyl-3,5-dinitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 108736202 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-methyl-3,5-dinitro-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzamide |
| SMILES | Cc1c(C(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O7S/c1-13-17(10-15(22(25)26)11-18(13)23(27)28)19(24)20-12-14-4-6-16(7-5-14)31(29,30)21-8-2-3-9-21/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,20,24) |
| InChIKey | OGASHFGZVLAJGL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|