C21H24ClFN2O3S — CID 108736474
N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2-chloro-6-fluorobenzamide (PubChem CID 108736474) has the molecular formula C21H24ClFN2O3S and a molecular weight of 438.95 g/mol. Its IUPAC name is N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 108736474 |
| Molecular Formula | C21H24ClFN2O3S |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2-chloro-6-fluorobenzamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C21H24ClFN2O3S/c22-18-6-5-7-19(23)20(18)21(26)24-13-12-16-8-10-17(11-9-16)29(27,28)25-14-3-1-2-4-15-25/h5-11H,1-4,12-15H2,(H,24,26) |
| InChIKey | NCWVWJMDHNYJAL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |