C24H26N4O2S — CID 10873758
2-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 10873758) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 10873758 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | CC1(C)C(=O)N(CCN2CCN(c3nsc4ccccc34)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H26N4O2S/c1-24(2)19-9-5-3-7-17(19)22(29)28(23(24)30)16-13-26-11-14-27(15-12-26)21-18-8-4-6-10-20(18)31-25-21/h3-10H,11-16H2,1-2H3 |
| InChIKey | VGJLNDMZKZPSKA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|