C25H40O6 — CID 10873795
ethyl 4-hydroxy-4-[(5R)-5-[(1R,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-2-methylidenebutanoate (PubChem CID 10873795) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(5R)-5-[(1R,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-hydroxy-4-[(5R)-5-[(1R,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 10873795 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | ethyl 4-hydroxy-4-[(5R)-5-[(1R,2E)-1-(2-methoxyethoxymethoxy)penta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]-2-methylidenebutanoate |
| SMILES | C=C/C=C/[C@@H](OCOCCOC)[C@@H]1CCC(C)=C(C(O)CC(=C)C(=O)OCC)C1(C)C |
| InChI | InChI=1S/C25H40O6/c1-8-10-11-22(31-17-29-15-14-28-7)20-13-12-18(3)23(25(20,5)6)21(26)16-19(4)24(27)30-9-2/h8,10-11,20-22,26H,1,4,9,12-17H2,2-3,5-7H3/b11-10+/t20-,21?,22+/m0/s1 |
| InChIKey | NXPLTSNPNZPRDV-LIYSAXMKSA-N |
| XLogP | 4.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|