C23H23N3O6 — CID 10873815
diethyl 6,20-dioxa-2,8,18-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),10,13,15,17(22)-heptaene-8,18-dicarboxylate (PubChem CID 10873815) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is diethyl 6,20-dioxa-2,8,18-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),10,13,15,17(22)-heptaene-8,18-dicarboxylate.
| Compound Name | diethyl 6,20-dioxa-2,8,18-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),10,13,15,17(22)-heptaene-8,18-dicarboxylate |
|---|---|
| PubChem CID | 10873815 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | diethyl 6,20-dioxa-2,8,18-triazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),10,13,15,17(22)-heptaene-8,18-dicarboxylate |
| SMILES | CCOC(=O)N1COCc2c1ccc1cc3ccc4c(c3nc21)COCN4C(=O)OCC |
| InChI | InChI=1S/C23H23N3O6/c1-3-31-22(27)25-12-29-10-16-18(25)7-5-14-9-15-6-8-19-17(21(15)24-20(14)16)11-30-13-26(19)23(28)32-4-2/h5-9H,3-4,10-13H2,1-2H3 |
| InChIKey | SMUVMOSYBRZRQF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|