C22H42O5Si2 — CID 10873919
(3aR,4R,5S,7aS)-5,7a-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one (PubChem CID 10873919) has the molecular formula C22H42O5Si2 and a molecular weight of 442.75 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-5,7a-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3aR,4R,5S,7aS)-5,7a-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10873919 |
| Molecular Formula | C22H42O5Si2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (3aR,4R,5S,7aS)-5,7a-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(hydroxymethyl)-4-methyl-3a,5-dihydro-3H-2-benzofuran-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@@]2(O[Si](C)(C)C(C)(C)C)C(=O)OC[C@H]2[C@]1(C)CO |
| InChI | InChI=1S/C22H42O5Si2/c1-19(2,3)28(8,9)26-17-12-13-22(27-29(10,11)20(4,5)6)16(14-25-18(22)24)21(17,7)15-23/h12-13,16-17,23H,14-15H2,1-11H3/t16-,17-,21-,22-/m0/s1 |
| InChIKey | FAFLBGDWSXSVMG-FHQLIMNDSA-N |
| XLogP | 4.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|