C25H30N4O4 — CID 10874054
1-N-[(4-carbamimidoylphenyl)methyl]-2-N-(3,5-dimethoxyphenyl)-2-N-ethylcyclopent-2-ene-1,2-dicarboxamide (PubChem CID 10874054) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-N-[(4-carbamimidoylphenyl)methyl]-2-N-(3,5-dimethoxyphenyl)-2-N-ethylcyclopent-2-ene-1,2-dicarboxamide.
| Compound Name | 1-N-[(4-carbamimidoylphenyl)methyl]-2-N-(3,5-dimethoxyphenyl)-2-N-ethylcyclopent-2-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10874054 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-N-[(4-carbamimidoylphenyl)methyl]-2-N-(3,5-dimethoxyphenyl)-2-N-ethylcyclopent-2-ene-1,2-dicarboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCC=C2C(=O)N(CC)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-4-29(18-12-19(32-2)14-20(13-18)33-3)25(31)22-7-5-6-21(22)24(30)28-15-16-8-10-17(11-9-16)23(26)27/h7-14,21H,4-6,15H2,1-3H3,(H3,26,27)(H,28,30) |
| InChIKey | ZYNLHKRATRATAC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|