C23H32O4Se — CID 10874069
(1R,2S,3R,7S,11E,13S,15S)-3-benzylselanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10874069) has the molecular formula C23H32O4Se and a molecular weight of 451.47 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-3-benzylselanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-3-benzylselanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10874069 |
| Molecular Formula | C23H32O4Se |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-3-benzylselanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)[C@H]([Se]Cc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C23H32O4Se/c1-16-8-4-2-7-11-18-12-19(24)13-20(18)23(26)21(14-22(25)27-16)28-15-17-9-5-3-6-10-17/h3,5-7,9-11,16,18-21,23-24,26H,2,4,8,12-15H2,1H3/b11-7+/t16-,18+,19-,20+,21+,23-/m0/s1 |
| InChIKey | ZGBSHMOYPHIUMT-LHHYAPNZSA-N |
| XLogP | 3.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|