C20H18Cl2N4O2 — CID 108741343
(3,6-dichloro-2-methoxyphenyl)-(4-quinoxalin-2-ylpiperazin-1-yl)methanone (PubChem CID 108741343) has the molecular formula C20H18Cl2N4O2 and a molecular weight of 417.30 g/mol. Its IUPAC name is (3,6-dichloro-2-methoxyphenyl)-(4-quinoxalin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (3,6-dichloro-2-methoxyphenyl)-(4-quinoxalin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 108741343 |
| Molecular Formula | C20H18Cl2N4O2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (3,6-dichloro-2-methoxyphenyl)-(4-quinoxalin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)N1CCN(c2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C20H18Cl2N4O2/c1-28-19-14(22)7-6-13(21)18(19)20(27)26-10-8-25(9-11-26)17-12-23-15-4-2-3-5-16(15)24-17/h2-7,12H,8-11H2,1H3 |
| InChIKey | NZPGLFXJYSQOGS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |