C23H31N5O3S — CID 10874168
(2S)-N-[(2S)-6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 10874168) has the molecular formula C23H31N5O3S and a molecular weight of 457.60 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10874168 |
| Molecular Formula | C23H31N5O3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-oxo-1-(1,3-thiazol-2-yl)hexan-2-yl]-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)Cc1ccccc1)C(=O)c1nccs1 |
| InChI | InChI=1S/C23H31N5O3S/c24-11-5-4-9-18(20(29)22-26-12-14-32-22)27-21(30)19-10-6-13-28(19)23(31)17(25)15-16-7-2-1-3-8-16/h1-3,7-8,12,14,17-19H,4-6,9-11,13,15,24-25H2,(H,27,30)/t17-,18+,19+/m1/s1 |
| InChIKey | FMWCHLNJNPJODN-QYZOEREBSA-N |
| XLogP | 1.50 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|