C17H16Cl4O6 — CID 10874172
[(1S,2S,7R,8R)-6-acetyloxy-1,8,9,10-tetrachloro-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-3,5,9-trienyl] acetate (PubChem CID 10874172) has the molecular formula C17H16Cl4O6 and a molecular weight of 458.12 g/mol. Its IUPAC name is [(1S,2S,7R,8R)-6-acetyloxy-1,8,9,10-tetrachloro-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-3,5,9-trienyl] acetate.
| Compound Name | [(1S,2S,7R,8R)-6-acetyloxy-1,8,9,10-tetrachloro-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-3,5,9-trienyl] acetate |
|---|---|
| PubChem CID | 10874172 |
| Molecular Formula | C17H16Cl4O6 |
| Molecular Weight | 458.12 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | [(1S,2S,7R,8R)-6-acetyloxy-1,8,9,10-tetrachloro-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-3,5,9-trienyl] acetate |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@@H]1C(OC(C)=O)=CC=C(OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C17H16Cl4O6/c1-7(22)26-9-5-6-10(27-8(2)23)12-11(9)15(20)13(18)14(19)16(12,21)17(15,24-3)25-4/h5-6,11-12H,1-4H3/t11-,12+,15-,16+ |
| InChIKey | NXPXOIKGBDWKAM-HMEQZMJYSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|