C17H17NO5 — CID 108741732
2-[3-[(3-ethoxybenzoyl)amino]-4-hydroxyphenyl]acetic acid (PubChem CID 108741732) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[3-[(3-ethoxybenzoyl)amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[(3-ethoxybenzoyl)amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 108741732 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[3-[(3-ethoxybenzoyl)amino]-4-hydroxyphenyl]acetic acid |
| SMILES | CCOc1cccc(C(=O)Nc2cc(CC(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C17H17NO5/c1-2-23-13-5-3-4-12(10-13)17(22)18-14-8-11(9-16(20)21)6-7-15(14)19/h3-8,10,19H,2,9H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | DGAIMXIMADPNBM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|