C24H31NO8 — CID 10874219
(2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]acetaldehyde (PubChem CID 10874219) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]acetaldehyde.
| Compound Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 10874219 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(3R,4S)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]acetaldehyde |
| SMILES | CO[C@H]1C(=O)N([C@@H](C=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)[C@H]1[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H31NO8/c1-23(2)29-12-15(31-23)19-18(32-24(3,4)33-19)14(11-26)25-16(21(28-5)22(25)27)20-17(30-20)13-9-7-6-8-10-13/h6-11,14-21H,12H2,1-5H3/t14-,15+,16-,17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | AJGDBZUBJJRPPP-KYDMIEGSSA-N |
| XLogP | 1.59 |
| TPSA | 96.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|