C28H19N3O2S — CID 10874220
1-benzoyl-4-phenylspiro[1,5-benzodiazepine-3,2'-3H-1,3-benzothiazole]-2-one (PubChem CID 10874220) has the molecular formula C28H19N3O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is 1-benzoyl-4-phenylspiro[1,5-benzodiazepine-3,2'-3H-1,3-benzothiazole]-2-one.
| Compound Name | 1-benzoyl-4-phenylspiro[1,5-benzodiazepine-3,2'-3H-1,3-benzothiazole]-2-one |
|---|---|
| PubChem CID | 10874220 |
| Molecular Formula | C28H19N3O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-benzoyl-4-phenylspiro[1,5-benzodiazepine-3,2'-3H-1,3-benzothiazole]-2-one |
| SMILES | O=C(c1ccccc1)N1C(=O)C2(Nc3ccccc3S2)C(c2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C28H19N3O2S/c32-26(20-13-5-2-6-14-20)31-23-17-9-7-15-21(23)29-25(19-11-3-1-4-12-19)28(27(31)33)30-22-16-8-10-18-24(22)34-28/h1-18,30H |
| InChIKey | SMLLBABBFWATIA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|