C27H50O4Si — CID 10874297
(2Z,10E)-2-[5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]dodeca-2,10-dienal (PubChem CID 10874297) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is (2Z,10E)-2-[5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]dodeca-2,10-dienal.
| Compound Name | (2Z,10E)-2-[5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]dodeca-2,10-dienal |
|---|---|
| PubChem CID | 10874297 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (2Z,10E)-2-[5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-5-yl]dodeca-2,10-dienal |
| SMILES | C/C=C/CCCCCC/C=C(\C=O)C1(CCCO[Si](C)(C)C(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C27H50O4Si/c1-9-10-11-12-13-14-15-16-18-24(21-28)27(22-29-26(5,6)30-23-27)19-17-20-31-32(7,8)25(2,3)4/h9-10,18,21H,11-17,19-20,22-23H2,1-8H3/b10-9+,24-18+ |
| InChIKey | CDSWKUUJNQTZRO-VYLPMRLUSA-N |
| XLogP | 7.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|