C26H21N7O — CID 108744669
5-methyl-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 108744669) has the molecular formula C26H21N7O and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-methyl-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108744669 |
| Molecular Formula | C26H21N7O |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-methyl-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Nc3cc(-c4ccccc4)ncn3)cc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C26H21N7O/c1-18-22(16-30-33(18)25-9-5-6-14-27-25)26(34)32-21-12-10-20(11-13-21)31-24-15-23(28-17-29-24)19-7-3-2-4-8-19/h2-17H,1H3,(H,32,34)(H,28,29,31) |
| InChIKey | UGXNANQSFWQSDU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |