C28H50O4Si — CID 10874487
[(2E,6E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethyl-14-oxohexadeca-2,6,10-trienyl] acetate (PubChem CID 10874487) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is [(2E,6E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethyl-14-oxohexadeca-2,6,10-trienyl] acetate.
| Compound Name | [(2E,6E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethyl-14-oxohexadeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 10874487 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | [(2E,6E,10E)-13-[tert-butyl(dimethyl)silyl]oxy-3,7,11,15-tetramethyl-14-oxohexadeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC(O[Si](C)(C)C(C)(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C28H50O4Si/c1-21(2)27(30)26(32-33(10,11)28(7,8)9)20-24(5)17-13-15-22(3)14-12-16-23(4)18-19-31-25(6)29/h14,17-18,21,26H,12-13,15-16,19-20H2,1-11H3/b22-14+,23-18+,24-17+ |
| InChIKey | ARRNOPBHIJKRTJ-CRCPWRPBSA-N |
| XLogP | 7.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|