C23H23N5O7 — CID 10874516
(2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methoxycarbonyl]benzoyl]amino]hexanedioic acid (PubChem CID 10874516) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methoxycarbonyl]benzoyl]amino]hexanedioic acid.
| Compound Name | (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methoxycarbonyl]benzoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 10874516 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methoxycarbonyl]benzoyl]amino]hexanedioic acid |
| SMILES | Nc1nc(N)c2cc(COC(=O)c3ccc(C(=O)N[C@@H](CCCC(=O)O)C(=O)O)cc3)ccc2n1 |
| InChI | InChI=1S/C23H23N5O7/c24-19-15-10-12(4-9-16(15)27-23(25)28-19)11-35-22(34)14-7-5-13(6-8-14)20(31)26-17(21(32)33)2-1-3-18(29)30/h4-10,17H,1-3,11H2,(H,26,31)(H,29,30)(H,32,33)(H4,24,25,27,28)/t17-/m0/s1 |
| InChIKey | GJUWHLSSVGPWOZ-KRWDZBQOSA-N |
| XLogP | 1.59 |
| TPSA | 207.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |