C20H35NO3 — CID 108745192
methyl 2-[[(4-butylcyclohexanecarbonyl)amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108745192) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is methyl 2-[[(4-butylcyclohexanecarbonyl)amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[(4-butylcyclohexanecarbonyl)amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108745192 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | methyl 2-[[(4-butylcyclohexanecarbonyl)amino]methyl]cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)NCC2CCCCC2C(=O)OC)CC1 |
| InChI | InChI=1S/C20H35NO3/c1-3-4-7-15-10-12-16(13-11-15)19(22)21-14-17-8-5-6-9-18(17)20(23)24-2/h15-18H,3-14H2,1-2H3,(H,21,22) |
| InChIKey | RLIPSWVFOGPDQX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |