C20H29NO4 — CID 108745280
methyl 2-[[[2-(3-propan-2-ylphenoxy)acetyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108745280) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is methyl 2-[[[2-(3-propan-2-ylphenoxy)acetyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[[2-(3-propan-2-ylphenoxy)acetyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108745280 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | methyl 2-[[[2-(3-propan-2-ylphenoxy)acetyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)COc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C20H29NO4/c1-14(2)15-8-6-9-17(11-15)25-13-19(22)21-12-16-7-4-5-10-18(16)20(23)24-3/h6,8-9,11,14,16,18H,4-5,7,10,12-13H2,1-3H3,(H,21,22) |
| InChIKey | XLWLNTGGCUQUEN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |