C24H37NO9 — CID 10874545
methyl (E,5S,6R,7S,9S,10R)-10-(2,5-dimethoxy-3-nitrophenyl)-6,7,10-trimethoxy-5,9-dimethyldec-3-enoate (PubChem CID 10874545) has the molecular formula C24H37NO9 and a molecular weight of 483.56 g/mol. Its IUPAC name is methyl (E,5S,6R,7S,9S,10R)-10-(2,5-dimethoxy-3-nitrophenyl)-6,7,10-trimethoxy-5,9-dimethyldec-3-enoate.
| Compound Name | methyl (E,5S,6R,7S,9S,10R)-10-(2,5-dimethoxy-3-nitrophenyl)-6,7,10-trimethoxy-5,9-dimethyldec-3-enoate |
|---|---|
| PubChem CID | 10874545 |
| Molecular Formula | C24H37NO9 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | methyl (E,5S,6R,7S,9S,10R)-10-(2,5-dimethoxy-3-nitrophenyl)-6,7,10-trimethoxy-5,9-dimethyldec-3-enoate |
| SMILES | COC(=O)C/C=C/[C@H](C)[C@@H](OC)[C@H](C[C@H](C)[C@@H](OC)c1cc(OC)cc([N+](=O)[O-])c1OC)OC |
| InChI | InChI=1S/C24H37NO9/c1-15(10-9-11-21(26)31-5)23(33-7)20(30-4)12-16(2)22(32-6)18-13-17(29-3)14-19(25(27)28)24(18)34-8/h9-10,13-16,20,22-23H,11-12H2,1-8H3/b10-9+/t15-,16-,20-,22+,23+/m0/s1 |
| InChIKey | IEJOKWLVWYFYDC-MAEDFGSNSA-N |
| XLogP | 4.11 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|