C26H48O6Si — CID 10874561
6-[dimethyl(propan-2-yl)silyl]oxy-5,5,10,10-tetramethyl-9-(oxan-2-yloxy)-oxacyclotridecane-7,8-dione (PubChem CID 10874561) has the molecular formula C26H48O6Si and a molecular weight of 484.75 g/mol. Its IUPAC name is 6-[dimethyl(propan-2-yl)silyl]oxy-5,5,10,10-tetramethyl-9-(oxan-2-yloxy)-oxacyclotridecane-7,8-dione.
| Compound Name | 6-[dimethyl(propan-2-yl)silyl]oxy-5,5,10,10-tetramethyl-9-(oxan-2-yloxy)-oxacyclotridecane-7,8-dione |
|---|---|
| PubChem CID | 10874561 |
| Molecular Formula | C26H48O6Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 6-[dimethyl(propan-2-yl)silyl]oxy-5,5,10,10-tetramethyl-9-(oxan-2-yloxy)-oxacyclotridecane-7,8-dione |
| SMILES | CC(C)[Si](C)(C)OC1C(=O)C(=O)C(OC2CCCCO2)C(C)(C)CCCOCCCC1(C)C |
| InChI | InChI=1S/C26H48O6Si/c1-19(2)33(7,8)32-24-22(28)21(27)23(31-20-13-9-10-18-30-20)25(3,4)14-11-16-29-17-12-15-26(24,5)6/h19-20,23-24H,9-18H2,1-8H3 |
| InChIKey | JKBCKNWGASDGKE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|