C24H22N6O6 — CID 108746046
N,N-diethyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-1-phenylpyrazole-4-carboxamide (PubChem CID 108746046) has the molecular formula C24H22N6O6 and a molecular weight of 490.48 g/mol. Its IUPAC name is N,N-diethyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N,N-diethyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108746046 |
| Molecular Formula | C24H22N6O6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N,N-diethyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnn(-c2ccccc2)c1NC(=O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C24H22N6O6/c1-3-27(4-2)22(32)19-13-25-29(15-8-6-5-7-9-15)21(19)26-20(31)14-28-23(33)17-11-10-16(30(35)36)12-18(17)24(28)34/h5-13H,3-4,14H2,1-2H3,(H,26,31) |
| InChIKey | XLOBBWLGHSEEMR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|