C23H19NO6 — CID 108746369
6-methoxy-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 108746369) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 6-methoxy-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 6-methoxy-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 108746369 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 6-methoxy-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(C(=O)c3cc4ccccc4oc3=O)C1)O2 |
| InChI | InChI=1S/C23H19NO6/c1-28-15-6-7-20-16(11-15)18(25)12-23(30-20)8-9-24(13-23)21(26)17-10-14-4-2-3-5-19(14)29-22(17)27/h2-7,10-11H,8-9,12-13H2,1H3 |
| InChIKey | MSJZPZPGBKVRGO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|