C24H37N5O6 — CID 10874655
(8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-pyridin-4-yl-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide (PubChem CID 10874655) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-pyridin-4-yl-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide.
| Compound Name | (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-pyridin-4-yl-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
|---|---|
| PubChem CID | 10874655 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-pyridin-4-yl-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C(=O)Nc2ccncc2)CCCCN(C)C(=O)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C24H37N5O6/c1-16(2)15-19-18(22(31)28-34)7-6-14-35-24(33)29(3)13-5-4-8-20(27-21(19)30)23(32)26-17-9-11-25-12-10-17/h9-12,16,18-20,34H,4-8,13-15H2,1-3H3,(H,27,30)(H,28,31)(H,25,26,32)/t18-,19+,20-/m0/s1 |
| InChIKey | GIAZVRZDQRZKPP-ZCNNSNEGSA-N |
| XLogP | 2.32 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|