C24H15N5O5S — CID 108748671
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 108748671) has the molecular formula C24H15N5O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 108748671 |
| Molecular Formula | C24H15N5O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1cccc(-c2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C24H15N5O5S/c30-20(12-28-23(31)17-5-2-6-19(29(33)34)21(17)24(28)32)26-16-4-1-3-15(11-16)18-13-35-22(27-18)14-7-9-25-10-8-14/h1-11,13H,12H2,(H,26,30) |
| InChIKey | GOGJSUMHYFHNHY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|