C30H56O4Si — CID 10874873
(E,4R)-4-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-2-methylpent-2-enal (PubChem CID 10874873) has the molecular formula C30H56O4Si and a molecular weight of 508.86 g/mol. Its IUPAC name is (E,4R)-4-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-2-methylpent-2-enal.
| Compound Name | (E,4R)-4-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-2-methylpent-2-enal |
|---|---|
| PubChem CID | 10874873 |
| Molecular Formula | C30H56O4Si |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.39 |
| IUPAC Name | (E,4R)-4-[(4S,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]-2-methylpent-2-enal |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@H]1OC(C)(C)O[C@@H]([C@H](C)/C=C(\C)C=O)C1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O4Si/c1-14-15-16-17-25(34-35(12,13)28(5,6)7)19-18-23(3)26-29(8,9)27(33-30(10,11)32-26)24(4)20-22(2)21-31/h18,20-21,24-27H,14-17,19H2,1-13H3/b22-20+,23-18+/t24-,25-,26-,27+/m1/s1 |
| InChIKey | CPRAGKUSXOKUKI-RFAQMKBJSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|