C18H15N3O3S — CID 108749134
[4-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylcarbamoyl]phenyl] acetate (PubChem CID 108749134) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is [4-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylcarbamoyl]phenyl] acetate.
| Compound Name | [4-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108749134 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [4-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)NCc2csc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c1-12(22)24-16-4-2-13(3-5-16)17(23)20-10-15-11-25-18(21-15)14-6-8-19-9-7-14/h2-9,11H,10H2,1H3,(H,20,23) |
| InChIKey | CFEKDUKACZDIJY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|