C22H22ClN3O2 — CID 108750234
1-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-phenoxybutan-1-one (PubChem CID 108750234) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108750234 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCc2[nH]nc(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-17-10-8-16(9-11-17)22-19-15-26(13-12-20(19)24-25-22)21(27)7-4-14-28-18-5-2-1-3-6-18/h1-3,5-6,8-11H,4,7,12-15H2,(H,24,25) |
| InChIKey | USHKYMYQNDLYGX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|