C28H48O5Si2 — CID 10875028
(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-one (PubChem CID 10875028) has the molecular formula C28H48O5Si2 and a molecular weight of 520.86 g/mol. Its IUPAC name is (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10875028 |
| Molecular Formula | C28H48O5Si2 |
| Molecular Weight | 520.86 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-one |
| SMILES | C/C(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1=O)=C/COC1CCCCO1 |
| InChI | InChI=1S/C28H48O5Si2/c1-21(17-19-31-24-14-12-13-18-30-24)15-16-22-20-23(32-34(8,9)27(2,3)4)26(25(22)29)33-35(10,11)28(5,6)7/h17,20,23-24,26H,12-14,18-19H2,1-11H3/b21-17-/t23-,24?,26+/m1/s1 |
| InChIKey | RETDSJKQXPBFIM-GTJAYITBSA-N |
| XLogP | 6.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|