C25H27ClN2O3 — CID 108751068
[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-hexoxyphenyl)methanone (PubChem CID 108751068) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-hexoxyphenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-hexoxyphenyl)methanone |
|---|---|
| PubChem CID | 108751068 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-hexoxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCc3noc(-c4ccc(Cl)cc4)c3C2)cc1 |
| InChI | InChI=1S/C25H27ClN2O3/c1-2-3-4-5-16-30-21-12-8-19(9-13-21)25(29)28-15-14-23-22(17-28)24(31-27-23)18-6-10-20(26)11-7-18/h6-13H,2-5,14-17H2,1H3 |
| InChIKey | JBRUKVXJZSQIRI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|