C28H24N4O3S — CID 108752624
(E)-3-(4-ethoxyphenyl)-N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-phenylprop-2-enamide (PubChem CID 108752624) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108752624 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[6-(2-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-phenylprop-2-enamide |
| SMILES | CCOc1ccc(/C=C(/C(=O)Nc2nc3scc(-c4ccccc4OC)n3n2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4O3S/c1-3-35-21-15-13-19(14-16-21)17-23(20-9-5-4-6-10-20)26(33)29-27-30-28-32(31-27)24(18-36-28)22-11-7-8-12-25(22)34-2/h4-18H,3H2,1-2H3,(H,29,31,33)/b23-17+ |
| InChIKey | VRVSJQGWKFFCGR-HAVVHWLPSA-N |
| XLogP | 6.04 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|