C30H44F2O7 — CID 10875351
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-4-(3-methylidenecyclopentyl)-3-oxobut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 10875351) has the molecular formula C30H44F2O7 and a molecular weight of 554.67 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-4-(3-methylidenecyclopentyl)-3-oxobut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-4-(3-methylidenecyclopentyl)-3-oxobut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10875351 |
| Molecular Formula | C30H44F2O7 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4,4-difluoro-4-(3-methylidenecyclopentyl)-3-oxobut-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | C=C1CCC(C(F)(F)C(=O)/C=C/[C@@H]2[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]2OC2CCCCO2)C1 |
| InChI | InChI=1S/C30H44F2O7/c1-20-13-14-22(18-20)30(31,32)27(34)16-15-24-23(10-6-4-5-7-11-28(35)36-3)25(38-21(2)33)19-26(24)39-29-12-8-9-17-37-29/h15-16,22-26,29H,1,4-14,17-19H2,2-3H3/b16-15+/t22?,23-,24-,25+,26-,29?/m1/s1 |
| InChIKey | FKQKAXJIHMWBIZ-LILNVTBESA-N |
| XLogP | 6.10 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|