C28H25N5O3 — CID 108753753
2-cyclohexyl-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108753753) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-cyclohexyl-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108753753 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-cyclohexyl-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(NC(=O)c3ccc4c(c3)C(=O)N(C3CCCCC3)C4=O)cc12 |
| InChI | InChI=1S/C28H25N5O3/c1-17-23-15-19(16-29-25(23)33(31-17)21-10-6-3-7-11-21)30-26(34)18-12-13-22-24(14-18)28(36)32(27(22)35)20-8-4-2-5-9-20/h3,6-7,10-16,20H,2,4-5,8-9H2,1H3,(H,30,34) |
| InChIKey | BUHSZSRKJXRWQM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|