C32H52O4Si2 — CID 10875376
(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,6-dimethylheptanal (PubChem CID 10875376) has the molecular formula C32H52O4Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is (2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,6-dimethylheptanal.
| Compound Name | (2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,6-dimethylheptanal |
|---|---|
| PubChem CID | 10875376 |
| Molecular Formula | C32H52O4Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-2,6-dimethylheptanal |
| SMILES | CO[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H52O4Si2/c1-25(23-33)30(36-37(10,11)31(3,4)5)22-29(34-9)26(2)24-35-38(32(6,7)8,27-18-14-12-15-19-27)28-20-16-13-17-21-28/h12-21,23,25-26,29-30H,22,24H2,1-11H3/t25-,26-,29+,30+/m0/s1 |
| InChIKey | VIDWVGBDAFVFOD-SRPPIYJJSA-N |
| XLogP | 6.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|